C8H11N3O2 — CID 177361980
1-[(1E)-1-aminobuta-1,3-dien-2-yl]-1,3-diazinane-2,4-dione (PubChem CID 177361980) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-[(1E)-1-aminobuta-1,3-dien-2-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(1E)-1-aminobuta-1,3-dien-2-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177361980 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1-[(1E)-1-aminobuta-1,3-dien-2-yl]-1,3-diazinane-2,4-dione |
| SMILES | C=C/C(=C\N)N1CCC(=O)NC1=O |
| InChI | InChI=1S/C8H11N3O2/c1-2-6(5-9)11-4-3-7(12)10-8(11)13/h2,5H,1,3-4,9H2,(H,10,12,13)/b6-5+ |
| InChIKey | HPIPFTOKIJTPGV-AATRIKPKSA-N |
| XLogP | -0.09 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|