C11H16N3O2+ — CID 170703555
1-(1-ethyl-1-methylpyrrol-1-ium-2-yl)-1,3-diazinane-2,4-dione (PubChem CID 170703555) has the molecular formula C11H16N3O2+ and a molecular weight of 222.27 g/mol. Its IUPAC name is 1-(1-ethyl-1-methylpyrrol-1-ium-2-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(1-ethyl-1-methylpyrrol-1-ium-2-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 170703555 |
| Molecular Formula | C11H16N3O2+ |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-(1-ethyl-1-methylpyrrol-1-ium-2-yl)-1,3-diazinane-2,4-dione |
| SMILES | CC[N+]1(C)C=CC=C1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C11H15N3O2/c1-3-14(2)8-4-5-10(14)13-7-6-9(15)12-11(13)16/h4-5,8H,3,6-7H2,1-2H3/p+1 |
| InChIKey | JLLFUUAWYDZUOE-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|