C19H22N4O — CID 171566765
1-[4-[[amino-[(Z)-2-amino-2-phenylethenyl]amino]methyl]-1,3-dihydroisoindol-2-yl]ethanone (PubChem CID 171566765) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[4-[[amino-[(Z)-2-amino-2-phenylethenyl]amino]methyl]-1,3-dihydroisoindol-2-yl]ethanone.
| Compound Name | 1-[4-[[amino-[(Z)-2-amino-2-phenylethenyl]amino]methyl]-1,3-dihydroisoindol-2-yl]ethanone |
|---|---|
| PubChem CID | 171566765 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-[4-[[amino-[(Z)-2-amino-2-phenylethenyl]amino]methyl]-1,3-dihydroisoindol-2-yl]ethanone |
| SMILES | CC(=O)N1Cc2cccc(CN(N)/C=C(\N)c3ccccc3)c2C1 |
| InChI | InChI=1S/C19H22N4O/c1-14(24)22-10-16-8-5-9-17(18(16)12-22)11-23(21)13-19(20)15-6-3-2-4-7-15/h2-9,13H,10-12,20-21H2,1H3/b19-13- |
| InChIKey | JTUADSGAFIFZDS-UYRXBGFRSA-N |
| XLogP | 2.18 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|