C22H28F2IN4O8P — CID 171568369
propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(iodomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 171568369) has the molecular formula C22H28F2IN4O8P and a molecular weight of 672.36 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(iodomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(iodomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 171568369 |
| Molecular Formula | C22H28F2IN4O8P |
| Molecular Weight | 672.36 g/mol |
| Exact Mass | 672.07 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-2-(iodomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@@]1(CI)O[C@@H](n2cc(F)c(N)nc2=O)[C@@H](F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H28F2IN4O8P/c1-12(2)35-20(31)13(3)28-38(33,37-14-7-5-4-6-8-14)34-11-22(10-25)17(30)16(24)19(36-22)29-9-15(23)18(26)27-21(29)32/h4-9,12-13,16-17,19,30H,10-11H2,1-3H3,(H,28,33)(H2,26,27,32)/t13-,16-,17-,19+,22+,38?/m0/s1 |
| InChIKey | FSGJJLDLEMTWRA-AUQOCVIJSA-N |
| XLogP | 2.50 |
| TPSA | 164.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|