About 1-decylpyrrolidin-1-ium acetate
1-decylpyrrolidin-1-ium acetate (PubChem CID 171569626) has the molecular formula C16H33NO2
and a molecular weight of 271.44 g/mol. Its IUPAC name is 1-decylpyrrolidin-1-ium acetate.
Molecular Properties
| Compound Name | 1-decylpyrrolidin-1-ium acetate |
| PubChem CID | 171569626 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 1-decylpyrrolidin-1-ium acetate |
| SMILES | CC(=O)[O-].CCCCCCCCCC[NH+]1CCCC1 |
| InChI | InChI=1S/C14H29N.C2H4O2/c1-2-3-4-5-6-7-8-9-12-15-13-10-11-14-15;1-2(3)4/h2-14H2,1H3;1H3,(H,3,4) |
| InChIKey | CAZADQARYOPZDX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-decylpyrrolidin-1-ium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decylpyrrolidin-1-ium acetate?
The IUPAC name of 1-decylpyrrolidin-1-ium acetate (CID 171569626) is 1-decylpyrrolidin-1-ium acetate.
What is the SMILES notation for 1-decylpyrrolidin-1-ium acetate?
The canonical SMILES for 1-decylpyrrolidin-1-ium acetate is CC(=O)[O-].CCCCCCCCCC[NH+]1CCCC1.
What is the InChIKey of 1-decylpyrrolidin-1-ium acetate?
The InChIKey is CAZADQARYOPZDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N.C2H4O2/c1-2-3-4-5-6-7-8-9-12-15-13-10-11-14-15;1-2(3)4/h2-14H2,1H3;1H3,(H,3,4).
What are the key properties of 1-decylpyrrolidin-1-ium acetate?
1-decylpyrrolidin-1-ium acetate has a molecular weight of 271.44 g/mol, XLogP of 1.56, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decylpyrrolidin-1-ium acetate is sourced from PubChem (CID 171569626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).