About 1-butylpyrrolidin-1-ium;dihydrogen phosphate
1-butylpyrrolidin-1-ium;dihydrogen phosphate (PubChem CID 163359822) has the molecular formula C8H20NO4P
and a molecular weight of 225.22 g/mol. Its IUPAC name is 1-butylpyrrolidin-1-ium;dihydrogen phosphate.
Molecular Properties
| Compound Name | 1-butylpyrrolidin-1-ium;dihydrogen phosphate |
| PubChem CID | 163359822 |
| Molecular Formula | C8H20NO4P |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-butylpyrrolidin-1-ium;dihydrogen phosphate |
| SMILES | CCCC[NH+]1CCCC1.O=P([O-])(O)O |
| InChI | InChI=1S/C8H17N.H3O4P/c1-2-3-6-9-7-4-5-8-9;1-5(2,3)4/h2-8H2,1H3;(H3,1,2,3,4) |
| InChIKey | PXADWKSVPOIYSO-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-butylpyrrolidin-1-ium;dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylpyrrolidin-1-ium;dihydrogen phosphate?
The IUPAC name of 1-butylpyrrolidin-1-ium;dihydrogen phosphate (CID 163359822) is 1-butylpyrrolidin-1-ium;dihydrogen phosphate.
What is the SMILES notation for 1-butylpyrrolidin-1-ium;dihydrogen phosphate?
The canonical SMILES for 1-butylpyrrolidin-1-ium;dihydrogen phosphate is CCCC[NH+]1CCCC1.O=P([O-])(O)O.
What is the InChIKey of 1-butylpyrrolidin-1-ium;dihydrogen phosphate?
The InChIKey is PXADWKSVPOIYSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.H3O4P/c1-2-3-6-9-7-4-5-8-9;1-5(2,3)4/h2-8H2,1H3;(H3,1,2,3,4).
What are the key properties of 1-butylpyrrolidin-1-ium;dihydrogen phosphate?
1-butylpyrrolidin-1-ium;dihydrogen phosphate has a molecular weight of 225.22 g/mol, XLogP of -1.10, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylpyrrolidin-1-ium;dihydrogen phosphate is sourced from PubChem (CID 163359822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).