About 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide
1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide (PubChem CID 166162243) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide.
Molecular Properties
| Compound Name | 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide |
| PubChem CID | 166162243 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide |
| SMILES | CCCC[NH+]1CCCC1.N#CN=C=[N-] |
| InChI | InChI=1S/C8H17N.C2N3/c1-2-3-6-9-7-4-5-8-9;3-1-5-2-4/h2-8H2,1H3;/q;-1/p+1 |
| InChIKey | HDPBBXVFRBVYDL-UHFFFAOYSA-O |
| XLogP | 0.68 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide?
The IUPAC name of 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide (CID 166162243) is 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide.
What is the SMILES notation for 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide?
The canonical SMILES for 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide is CCCC[NH+]1CCCC1.N#CN=C=[N-].
What is the InChIKey of 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide?
The InChIKey is HDPBBXVFRBVYDL-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H17N.C2N3/c1-2-3-6-9-7-4-5-8-9;3-1-5-2-4/h2-8H2,1H3;/q;-1/p+1.
What are the key properties of 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide?
1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide has a molecular weight of 194.28 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylpyrrolidin-1-ium;cyanoiminomethylideneazanide is sourced from PubChem (CID 166162243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).