C30H33N3O4S — CID 171571702
5-[bis[(3-methoxyphenyl)methyl]amino]-N-[3-(4-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 171571702) has the molecular formula C30H33N3O4S and a molecular weight of 531.68 g/mol. Its IUPAC name is 5-[bis[(3-methoxyphenyl)methyl]amino]-N-[3-(4-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 5-[bis[(3-methoxyphenyl)methyl]amino]-N-[3-(4-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 171571702 |
| Molecular Formula | C30H33N3O4S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 5-[bis[(3-methoxyphenyl)methyl]amino]-N-[3-(4-methoxyphenyl)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)c2ncsc2N(Cc2cccc(OC)c2)Cc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C30H33N3O4S/c1-35-25-14-12-22(13-15-25)9-6-16-31-29(34)28-30(38-21-32-28)33(19-23-7-4-10-26(17-23)36-2)20-24-8-5-11-27(18-24)37-3/h4-5,7-8,10-15,17-18,21H,6,9,16,19-20H2,1-3H3,(H,31,34) |
| InChIKey | RIURJOJUBSFTQJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|