C19H26F3NO — CID 171576155
(2S)-4-methyl-2-[propan-2-yl(prop-2-enyl)amino]-1-[4-(trifluoromethyl)phenyl]pentan-3-one (PubChem CID 171576155) has the molecular formula C19H26F3NO and a molecular weight of 341.42 g/mol. Its IUPAC name is (2S)-4-methyl-2-[propan-2-yl(prop-2-enyl)amino]-1-[4-(trifluoromethyl)phenyl]pentan-3-one.
| Compound Name | (2S)-4-methyl-2-[propan-2-yl(prop-2-enyl)amino]-1-[4-(trifluoromethyl)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 171576155 |
| Molecular Formula | C19H26F3NO |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (2S)-4-methyl-2-[propan-2-yl(prop-2-enyl)amino]-1-[4-(trifluoromethyl)phenyl]pentan-3-one |
| SMILES | C=CCN(C(C)C)[C@@H](Cc1ccc(C(F)(F)F)cc1)C(=O)C(C)C |
| InChI | InChI=1S/C19H26F3NO/c1-6-11-23(14(4)5)17(18(24)13(2)3)12-15-7-9-16(10-8-15)19(20,21)22/h6-10,13-14,17H,1,11-12H2,2-5H3/t17-/m0/s1 |
| InChIKey | LZGIOSGPHMLINH-KRWDZBQOSA-N |
| XLogP | 4.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|