C52H42N5OPt-3 — CID 171576210
CID 171576210 (PubChem CID 171576210) has the molecular formula C52H42N5OPt-3 and a molecular weight of 948.02 g/mol.
| Compound Name | CID 171576210 |
|---|---|
| PubChem CID | 171576210 |
| Molecular Formula | C52H42N5OPt-3 |
| Molecular Weight | 948.02 g/mol |
| Exact Mass | 947.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(N5C=CN(C(C)(C)C)[CH-]5)ccc4)ccc3c3c4c(ccc32)-n2c3ccccc3c3cccc(c32)-c2ccccc2-4)c1.[Pt] |
| InChI | InChI=1S/C52H42N5O.Pt/c1-51(2,3)33-25-26-53-47(29-33)56-44-23-24-45-48(39-17-8-7-15-37(39)40-18-12-19-41-38-16-9-10-20-43(38)57(45)50(40)41)49(44)42-22-21-36(31-46(42)56)58-35-14-11-13-34(30-35)54-27-28-55(32-54)52(4,5)6;/h7-29,32H,1-6H3;/q-3; |
| InChIKey | UQLRANQCQDBNAY-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.02 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|