C55H40N5OPt-3 — CID 171576285
CID 171576285 (PubChem CID 171576285) has the molecular formula C55H40N5OPt-3 and a molecular weight of 985.06 g/mol.
| Compound Name | CID 171576285 |
|---|---|
| PubChem CID | 171576285 |
| Molecular Formula | C55H40N5OPt-3 |
| Molecular Weight | 985.06 g/mol |
| Exact Mass | 984.31 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1ccc(N2C=CN(c3[c-]c(Oc4[c-]c5c(cc4)c4c6c(ccc4n5-c4cc(C(C)(C)C)ccn4)-n4c5ccccc5c5cccc(c54)-c4ccccc4-6)ccc3)[CH-]2)cc1.[Pt] |
| InChI | InChI=1S/C55H40N5O.Pt/c1-35-19-21-37(22-20-35)57-29-30-58(34-57)38-11-9-12-39(32-38)61-40-23-24-46-50(33-40)59(51-31-36(27-28-56-51)55(2,3)4)48-25-26-49-52(53(46)48)43-15-6-5-13-41(43)44-16-10-17-45-42-14-7-8-18-47(42)60(49)54(44)45;/h5-31,34H,1-4H3;/q-3;/i1D3; |
| InChIKey | VKHBQMFHOXOQFP-NIIDSAIPSA-N |
| XLogP | 13.84 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.06 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|