C32H60N2O2Si4 — CID 171577210
N-[4-[[3,5-bis(trimethylsilyl)cyclohexanecarbonyl]amino]phenyl]-3,5-bis(trimethylsilyl)cyclohexane-1-carboxamide (PubChem CID 171577210) has the molecular formula C32H60N2O2Si4 and a molecular weight of 617.19 g/mol. Its IUPAC name is N-[4-[[3,5-bis(trimethylsilyl)cyclohexanecarbonyl]amino]phenyl]-3,5-bis(trimethylsilyl)cyclohexane-1-carboxamide.
| Compound Name | N-[4-[[3,5-bis(trimethylsilyl)cyclohexanecarbonyl]amino]phenyl]-3,5-bis(trimethylsilyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 171577210 |
| Molecular Formula | C32H60N2O2Si4 |
| Molecular Weight | 617.19 g/mol |
| Exact Mass | 616.37 |
| IUPAC Name | N-[4-[[3,5-bis(trimethylsilyl)cyclohexanecarbonyl]amino]phenyl]-3,5-bis(trimethylsilyl)cyclohexane-1-carboxamide |
| SMILES | C[Si](C)(C)C1CC(C(=O)Nc2ccc(NC(=O)C3CC([Si](C)(C)C)CC([Si](C)(C)C)C3)cc2)CC([Si](C)(C)C)C1 |
| InChI | InChI=1S/C32H60N2O2Si4/c1-37(2,3)27-17-23(18-28(21-27)38(4,5)6)31(35)33-25-13-15-26(16-14-25)34-32(36)24-19-29(39(7,8)9)22-30(20-24)40(10,11)12/h13-16,23-24,27-30H,17-22H2,1-12H3,(H,33,35)(H,34,36) |
| InChIKey | CKPFOCLTVCAJDH-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.19 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|