C26H44N2O2Si2 — CID 171577071
4-trimethylsilyl-N-[2-[(4-trimethylsilylcyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide (PubChem CID 171577071) has the molecular formula C26H44N2O2Si2 and a molecular weight of 472.82 g/mol. Its IUPAC name is 4-trimethylsilyl-N-[2-[(4-trimethylsilylcyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide.
| Compound Name | 4-trimethylsilyl-N-[2-[(4-trimethylsilylcyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 171577071 |
| Molecular Formula | C26H44N2O2Si2 |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | 4-trimethylsilyl-N-[2-[(4-trimethylsilylcyclohexanecarbonyl)amino]phenyl]cyclohexane-1-carboxamide |
| SMILES | C[Si](C)(C)C1CCC(C(=O)Nc2ccccc2NC(=O)C2CCC([Si](C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C26H44N2O2Si2/c1-31(2,3)21-15-11-19(12-16-21)25(29)27-23-9-7-8-10-24(23)28-26(30)20-13-17-22(18-14-20)32(4,5)6/h7-10,19-22H,11-18H2,1-6H3,(H,27,29)(H,28,30) |
| InChIKey | YORLWAZAVULGDO-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|