C17H26N3O+ — CID 21440518
1-[2-(cyclohexanecarbonylamino)anilino]ethylidene-dimethylazanium (PubChem CID 21440518) has the molecular formula C17H26N3O+ and a molecular weight of 288.42 g/mol. Its IUPAC name is 1-[2-(cyclohexanecarbonylamino)anilino]ethylidene-dimethylazanium.
| Compound Name | 1-[2-(cyclohexanecarbonylamino)anilino]ethylidene-dimethylazanium |
|---|---|
| PubChem CID | 21440518 |
| Molecular Formula | C17H26N3O+ |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1-[2-(cyclohexanecarbonylamino)anilino]ethylidene-dimethylazanium |
| SMILES | CC(Nc1ccccc1NC(=O)C1CCCCC1)=[N+](C)C |
| InChI | InChI=1S/C17H25N3O/c1-13(20(2)3)18-15-11-7-8-12-16(15)19-17(21)14-9-5-4-6-10-14/h7-8,11-12,14H,4-6,9-10H2,1-3H3,(H,19,21)/p+1 |
| InChIKey | NRHQFDMLRILHJB-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 44.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|