C26H29N5O3 — CID 171577464
3-[6-[5-(1-adamantyl)-1-methyl-1,2,4-triazol-3-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171577464) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is 3-[6-[5-(1-adamantyl)-1-methyl-1,2,4-triazol-3-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-(1-adamantyl)-1-methyl-1,2,4-triazol-3-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171577464 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 3-[6-[5-(1-adamantyl)-1-methyl-1,2,4-triazol-3-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cn1nc(-c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)nc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H29N5O3/c1-30-25(26-10-14-6-15(11-26)8-16(7-14)12-26)28-22(29-30)17-2-3-19-18(9-17)13-31(24(19)34)20-4-5-21(32)27-23(20)33/h2-3,9,14-16,20H,4-8,10-13H2,1H3,(H,27,32,33) |
| InChIKey | QRMSLATVAXIQSX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|