C57H34N6S — CID 171578172
9-[4-(2-carbazol-9-yl-6-dibenzothiophen-1-ylphenyl)-6-(1,2,3,4-tetradeuteriocarbazol-9-yl)-1,3,5-triazin-2-yl]-1,2,3,4-tetradeuteriocarbazole (PubChem CID 171578172) has the molecular formula C57H34N6S and a molecular weight of 843.06 g/mol. Its IUPAC name is 9-[4-(2-carbazol-9-yl-6-dibenzothiophen-1-ylphenyl)-6-(1,2,3,4-tetradeuteriocarbazol-9-yl)-1,3,5-triazin-2-yl]-1,2,3,4-tetradeuteriocarbazole.
| Compound Name | 9-[4-(2-carbazol-9-yl-6-dibenzothiophen-1-ylphenyl)-6-(1,2,3,4-tetradeuteriocarbazol-9-yl)-1,3,5-triazin-2-yl]-1,2,3,4-tetradeuteriocarbazole |
|---|---|
| PubChem CID | 171578172 |
| Molecular Formula | C57H34N6S |
| Molecular Weight | 843.06 g/mol |
| Exact Mass | 842.31 |
| IUPAC Name | 9-[4-(2-carbazol-9-yl-6-dibenzothiophen-1-ylphenyl)-6-(1,2,3,4-tetradeuteriocarbazol-9-yl)-1,3,5-triazin-2-yl]-1,2,3,4-tetradeuteriocarbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1ccccc1n2-c1nc(-c2c(-c3cccc4sc5ccccc5c34)cccc2-n2c3ccccc3c3ccccc32)nc(-n2c3ccccc3c3c([2H])c([2H])c([2H])c([2H])c32)n1 |
| InChI | InChI=1S/C57H34N6S/c1-8-26-44-35(17-1)36-18-2-9-27-45(36)61(44)50-32-15-24-42(41-25-16-34-52-53(41)43-23-7-14-33-51(43)64-52)54(50)55-58-56(62-46-28-10-3-19-37(46)38-20-4-11-29-47(38)62)60-57(59-55)63-48-30-12-5-21-39(48)40-22-6-13-31-49(40)63/h1-34H/i3D,5D,10D,12D,19D,21D,28D,30D |
| InChIKey | BNGBCMLPENFUJU-HHNKSUQQSA-N |
| XLogP | 14.86 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.06 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |