C33H28N4O — CID 171578808
4-[3,5-di(propan-2-yl)phenyl]-7-perimidin-1-yl-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 171578808) has the molecular formula C33H28N4O and a molecular weight of 496.61 g/mol. Its IUPAC name is 4-[3,5-di(propan-2-yl)phenyl]-7-perimidin-1-yl-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 4-[3,5-di(propan-2-yl)phenyl]-7-perimidin-1-yl-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 171578808 |
| Molecular Formula | C33H28N4O |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 4-[3,5-di(propan-2-yl)phenyl]-7-perimidin-1-yl-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | CC(C)c1cc(-c2ncnc3c2oc2cc(N4C=Nc5cccc6cccc4c56)ccc23)cc(C(C)C)c1 |
| InChI | InChI=1S/C33H28N4O/c1-19(2)22-13-23(20(3)4)15-24(14-22)31-33-32(35-17-34-31)26-12-11-25(16-29(26)38-33)37-18-36-27-9-5-7-21-8-6-10-28(37)30(21)27/h5-20H,1-4H3 |
| InChIKey | IJLPAJNPWVHTLT-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 54.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'} |
|---|