C20H41N3O — CID 171579080
1-[(2S)-2-[(hexylamino)methyl]-1,4-diazepan-1-yl]octan-1-one (PubChem CID 171579080) has the molecular formula C20H41N3O and a molecular weight of 339.57 g/mol. Its IUPAC name is 1-[(2S)-2-[(hexylamino)methyl]-1,4-diazepan-1-yl]octan-1-one.
| Compound Name | 1-[(2S)-2-[(hexylamino)methyl]-1,4-diazepan-1-yl]octan-1-one |
|---|---|
| PubChem CID | 171579080 |
| Molecular Formula | C20H41N3O |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.32 |
| IUPAC Name | 1-[(2S)-2-[(hexylamino)methyl]-1,4-diazepan-1-yl]octan-1-one |
| SMILES | CCCCCCCC(=O)N1CCCNC[C@@H]1CNCCCCCC |
| InChI | InChI=1S/C20H41N3O/c1-3-5-7-9-10-13-20(24)23-16-12-15-22-18-19(23)17-21-14-11-8-6-4-2/h19,21-22H,3-18H2,1-2H3/t19-/m0/s1 |
| InChIKey | MIBUZZXYJARVKG-IBGZPJMESA-N |
| XLogP | 3.71 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|