C17H26N2O — CID 82248077
1-(2-benzyl-1,4-diazepan-1-yl)pentan-1-one (PubChem CID 82248077) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-(2-benzyl-1,4-diazepan-1-yl)pentan-1-one.
| Compound Name | 1-(2-benzyl-1,4-diazepan-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 82248077 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1-(2-benzyl-1,4-diazepan-1-yl)pentan-1-one |
| SMILES | CCCCC(=O)N1CCCNCC1Cc1ccccc1 |
| InChI | InChI=1S/C17H26N2O/c1-2-3-10-17(20)19-12-7-11-18-14-16(19)13-15-8-5-4-6-9-15/h4-6,8-9,16,18H,2-3,7,10-14H2,1H3 |
| InChIKey | RGVVCHSDYIFFDM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |