C15H25N3O4S — CID 171580698
2-[[4-(3-butylsulfanylpropoxy)-6-prop-2-enoxy-1,3,5-triazin-2-yl]oxy]ethanol (PubChem CID 171580698) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[[4-(3-butylsulfanylpropoxy)-6-prop-2-enoxy-1,3,5-triazin-2-yl]oxy]ethanol.
| Compound Name | 2-[[4-(3-butylsulfanylpropoxy)-6-prop-2-enoxy-1,3,5-triazin-2-yl]oxy]ethanol |
|---|---|
| PubChem CID | 171580698 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[[4-(3-butylsulfanylpropoxy)-6-prop-2-enoxy-1,3,5-triazin-2-yl]oxy]ethanol |
| SMILES | C=CCOc1nc(OCCO)nc(OCCCSCCCC)n1 |
| InChI | InChI=1S/C15H25N3O4S/c1-3-5-11-23-12-6-9-21-14-16-13(20-8-4-2)17-15(18-14)22-10-7-19/h4,19H,2-3,5-12H2,1H3 |
| InChIKey | CQGJPKUCXPOGFH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|