C14H23N3O4S — CID 171580699
2-[[4-prop-2-enoxy-6-(3-propylsulfanylpropoxy)-1,3,5-triazin-2-yl]oxy]ethanol (PubChem CID 171580699) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-[[4-prop-2-enoxy-6-(3-propylsulfanylpropoxy)-1,3,5-triazin-2-yl]oxy]ethanol.
| Compound Name | 2-[[4-prop-2-enoxy-6-(3-propylsulfanylpropoxy)-1,3,5-triazin-2-yl]oxy]ethanol |
|---|---|
| PubChem CID | 171580699 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[[4-prop-2-enoxy-6-(3-propylsulfanylpropoxy)-1,3,5-triazin-2-yl]oxy]ethanol |
| SMILES | C=CCOc1nc(OCCO)nc(OCCCSCCC)n1 |
| InChI | InChI=1S/C14H23N3O4S/c1-3-7-19-12-15-13(17-14(16-12)21-9-6-18)20-8-5-11-22-10-4-2/h3,18H,1,4-11H2,2H3 |
| InChIKey | LNLIYRKWDGCVHH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|