C43H43IrN2O3- — CID 171581422
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;13-(4-phenyl-1H-naphthalen-1-id-2-yl)-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12(17),13,15-heptaene (PubChem CID 171581422) has the molecular formula C43H43IrN2O3- and a molecular weight of 828.04 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;13-(4-phenyl-1H-naphthalen-1-id-2-yl)-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12(17),13,15-heptaene.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;13-(4-phenyl-1H-naphthalen-1-id-2-yl)-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12(17),13,15-heptaene |
|---|---|
| PubChem CID | 171581422 |
| Molecular Formula | C43H43IrN2O3- |
| Molecular Weight | 828.04 g/mol |
| Exact Mass | 828.29 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium;13-(4-phenyl-1H-naphthalen-1-id-2-yl)-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12(17),13,15-heptaene |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].[c-]1c(-c2ncnc3c4c(oc23)CCc2ccccc2-4)cc(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C30H19N2O.C13H24O2.Ir/c1-2-8-19(9-3-1)25-17-22(16-21-11-5-6-12-23(21)25)28-30-29(32-18-31-28)27-24-13-7-4-10-20(24)14-15-26(27)33-30;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-13,17-18H,14-15H2;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | XWGUDIRSZOMHPP-DZTQYQPZSA-N |
| XLogP | 11.14 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.04 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|