C10H19F2NO3S — CID 171582012
(3S,4S)-4-tert-butyl-1-(difluoromethylsulfonyl)piperidin-3-ol (PubChem CID 171582012) has the molecular formula C10H19F2NO3S and a molecular weight of 271.33 g/mol. Its IUPAC name is (3S,4S)-4-tert-butyl-1-(difluoromethylsulfonyl)piperidin-3-ol.
| Compound Name | (3S,4S)-4-tert-butyl-1-(difluoromethylsulfonyl)piperidin-3-ol |
|---|---|
| PubChem CID | 171582012 |
| Molecular Formula | C10H19F2NO3S |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (3S,4S)-4-tert-butyl-1-(difluoromethylsulfonyl)piperidin-3-ol |
| SMILES | CC(C)(C)[C@@H]1CCN(S(=O)(=O)C(F)F)C[C@H]1O |
| InChI | InChI=1S/C10H19F2NO3S/c1-10(2,3)7-4-5-13(6-8(7)14)17(15,16)9(11)12/h7-9,14H,4-6H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | WLFSYRRKDJXOPB-HTQZYQBOSA-N |
| XLogP | 1.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |