C7H12F3NO3S — CID 176688190
(3S,4S)-4-methyl-1-(trifluoromethylsulfonyl)piperidin-3-ol (PubChem CID 176688190) has the molecular formula C7H12F3NO3S and a molecular weight of 247.24 g/mol. Its IUPAC name is (3S,4S)-4-methyl-1-(trifluoromethylsulfonyl)piperidin-3-ol.
| Compound Name | (3S,4S)-4-methyl-1-(trifluoromethylsulfonyl)piperidin-3-ol |
|---|---|
| PubChem CID | 176688190 |
| Molecular Formula | C7H12F3NO3S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (3S,4S)-4-methyl-1-(trifluoromethylsulfonyl)piperidin-3-ol |
| SMILES | C[C@H]1CCN(S(=O)(=O)C(F)(F)F)C[C@H]1O |
| InChI | InChI=1S/C7H12F3NO3S/c1-5-2-3-11(4-6(5)12)15(13,14)7(8,9)10/h5-6,12H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | WRKRVOALUSRZKN-NTSWFWBYSA-N |
| XLogP | 0.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |