C33H31N7O6S2 — CID 171585951
N-[4-(ethylamino)-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)-4-[4-(3-thiophen-2-ylprop-2-ynyl)piperazin-1-yl]benzamide (PubChem CID 171585951) has the molecular formula C33H31N7O6S2 and a molecular weight of 685.79 g/mol. Its IUPAC name is N-[4-(ethylamino)-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)-4-[4-(3-thiophen-2-ylprop-2-ynyl)piperazin-1-yl]benzamide.
| Compound Name | N-[4-(ethylamino)-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)-4-[4-(3-thiophen-2-ylprop-2-ynyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 171585951 |
| Molecular Formula | C33H31N7O6S2 |
| Molecular Weight | 685.79 g/mol |
| Exact Mass | 685.18 |
| IUPAC Name | N-[4-(ethylamino)-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)-4-[4-(3-thiophen-2-ylprop-2-ynyl)piperazin-1-yl]benzamide |
| SMILES | CCNc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(CC#Cc4cccs4)CC3)cc2Oc2cnc3[nH]ccc3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H31N7O6S2/c1-2-34-29-10-8-27(21-30(29)40(42)43)48(44,45)37-33(41)28-9-7-24(20-31(28)46-25-19-23-11-12-35-32(23)36-22-25)39-16-14-38(15-17-39)13-3-5-26-6-4-18-47-26/h4,6-12,18-22,34H,2,13-17H2,1H3,(H,35,36)(H,37,41) |
| InChIKey | LEKCXTGXJUCBPH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 162.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.79 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|