C26H27N5O2 — CID 171586071
5-(4-isocyanophenyl)-2-[4-methyl-6-[[(3R)-1-(oxetan-3-yl)piperidin-3-yl]amino]pyridazin-3-yl]phenol (PubChem CID 171586071) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 5-(4-isocyanophenyl)-2-[4-methyl-6-[[(3R)-1-(oxetan-3-yl)piperidin-3-yl]amino]pyridazin-3-yl]phenol.
| Compound Name | 5-(4-isocyanophenyl)-2-[4-methyl-6-[[(3R)-1-(oxetan-3-yl)piperidin-3-yl]amino]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 171586071 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 5-(4-isocyanophenyl)-2-[4-methyl-6-[[(3R)-1-(oxetan-3-yl)piperidin-3-yl]amino]pyridazin-3-yl]phenol |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3nnc(N[C@@H]4CCCN(C5COC5)C4)cc3C)c(O)c2)cc1 |
| InChI | InChI=1S/C26H27N5O2/c1-17-12-25(28-21-4-3-11-31(14-21)22-15-33-16-22)29-30-26(17)23-10-7-19(13-24(23)32)18-5-8-20(27-2)9-6-18/h5-10,12-13,21-22,32H,3-4,11,14-16H2,1H3,(H,28,29)/t21-/m1/s1 |
| InChIKey | JOEOCANIVPWPQF-OAQYLSRUSA-N |
| XLogP | 4.65 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|