C21H24N4OS — CID 170443209
5-[6-[[(6R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol (PubChem CID 170443209) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 5-[6-[[(6R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol.
| Compound Name | 5-[6-[[(6R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 170443209 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 5-[6-[[(6R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol |
| SMILES | Cc1cc(N[C@@H]2CC[C@@H]3CCCN3C2)nnc1-c1ccc2sccc2c1O |
| InChI | InChI=1S/C21H24N4OS/c1-13-11-19(22-14-4-5-15-3-2-9-25(15)12-14)23-24-20(13)17-6-7-18-16(21(17)26)8-10-27-18/h6-8,10-11,14-15,26H,2-5,9,12H2,1H3,(H,22,23)/t14-,15+/m1/s1 |
| InChIKey | FPRUWKJNXQBHPH-CABCVRRESA-N |
| XLogP | 4.41 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |