About 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol
5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol (PubChem CID 170443425) has the molecular formula C19H21N3O2S
and a molecular weight of 355.46 g/mol. Its IUPAC name is 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol.
Molecular Properties
| Compound Name | 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol |
| PubChem CID | 170443425 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol |
| SMILES | Cc1cc(N[C@@H]2CCCC[C@@H]2O)nnc1-c1ccc2sccc2c1O |
| InChI | InChI=1S/C19H21N3O2S/c1-11-10-17(20-14-4-2-3-5-15(14)23)21-22-18(11)13-6-7-16-12(19(13)24)8-9-25-16/h6-10,14-15,23-24H,2-5H2,1H3,(H,20,21)/t14-,15+/m1/s1 |
| InChIKey | AKYFELMWECZVRI-CABCVRRESA-N |
| XLogP | 4.09 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol?
The IUPAC name of 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol (CID 170443425) is 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol.
What is the SMILES notation for 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol?
The canonical SMILES for 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol is Cc1cc(N[C@@H]2CCCC[C@@H]2O)nnc1-c1ccc2sccc2c1O.
What is the InChIKey of 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol?
The InChIKey is AKYFELMWECZVRI-CABCVRRESA-N. The full InChI is InChI=1S/C19H21N3O2S/c1-11-10-17(20-14-4-2-3-5-15(14)23)21-22-18(11)13-6-7-16-12(19(13)24)8-9-25-16/h6-10,14-15,23-24H,2-5H2,1H3,(H,20,21)/t14-,15+/m1/s1.
What are the key properties of 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol?
5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol has a molecular weight of 355.46 g/mol, XLogP of 4.09, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-[[(1R,2S)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-1-benzothiophen-4-ol is sourced from PubChem (CID 170443425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).