C20H23N3O2 — CID 171545314
2-[6-[[(1S,2R)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-5-prop-1-ynylphenol (PubChem CID 171545314) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[6-[[(1S,2R)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-5-prop-1-ynylphenol.
| Compound Name | 2-[6-[[(1S,2R)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-5-prop-1-ynylphenol |
|---|---|
| PubChem CID | 171545314 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2-[6-[[(1S,2R)-2-hydroxycyclohexyl]amino]-4-methylpyridazin-3-yl]-5-prop-1-ynylphenol |
| SMILES | CC#Cc1ccc(-c2nnc(N[C@H]3CCCC[C@H]3O)cc2C)c(O)c1 |
| InChI | InChI=1S/C20H23N3O2/c1-3-6-14-9-10-15(18(25)12-14)20-13(2)11-19(22-23-20)21-16-7-4-5-8-17(16)24/h9-12,16-17,24-25H,4-5,7-8H2,1-2H3,(H,21,22)/t16-,17+/m0/s1 |
| InChIKey | CLARUJCVJVPDAK-DLBZAZTESA-N |
| XLogP | 3.24 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|