C19H28N4O8S — CID 171586396
7-O-tert-butyl 8-O-methyl (8S,8aS)-2-[3-(methanesulfonamido)-1-bicyclo[1.1.1]pentanyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7,8-dicarboxylate (PubChem CID 171586396) has the molecular formula C19H28N4O8S and a molecular weight of 472.52 g/mol. Its IUPAC name is 7-O-tert-butyl 8-O-methyl (8S,8aS)-2-[3-(methanesulfonamido)-1-bicyclo[1.1.1]pentanyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7,8-dicarboxylate.
| Compound Name | 7-O-tert-butyl 8-O-methyl (8S,8aS)-2-[3-(methanesulfonamido)-1-bicyclo[1.1.1]pentanyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7,8-dicarboxylate |
|---|---|
| PubChem CID | 171586396 |
| Molecular Formula | C19H28N4O8S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 7-O-tert-butyl 8-O-methyl (8S,8aS)-2-[3-(methanesulfonamido)-1-bicyclo[1.1.1]pentanyl]-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C(=O)N(C34CC(NS(C)(=O)=O)(C3)C4)C(=O)N2CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28N4O8S/c1-17(2,3)31-16(27)22-7-6-21-11(12(22)14(25)30-4)13(24)23(15(21)26)19-8-18(9-19,10-19)20-32(5,28)29/h11-12,20H,6-10H2,1-5H3/t11-,12-,18?,19?/m0/s1 |
| InChIKey | CIZSXECVEWXINX-VMFHFQHDSA-N |
| XLogP | -0.36 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|