C22H29F3N4O6 — CID 171587640
tert-butyl (11R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxo-5-(trifluoromethyl)-9-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene-13-carboxylate (PubChem CID 171587640) has the molecular formula C22H29F3N4O6 and a molecular weight of 502.49 g/mol. Its IUPAC name is tert-butyl (11R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxo-5-(trifluoromethyl)-9-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene-13-carboxylate.
| Compound Name | tert-butyl (11R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxo-5-(trifluoromethyl)-9-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene-13-carboxylate |
|---|---|
| PubChem CID | 171587640 |
| Molecular Formula | C22H29F3N4O6 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | tert-butyl (11R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-8-oxo-5-(trifluoromethyl)-9-oxa-1,3,13-triazatricyclo[9.4.0.02,7]pentadeca-2,4,6-triene-13-carboxylate |
| SMILES | CC(C)(C)OC(=O)Nc1nc2c(cc1C(F)(F)F)C(=O)OC[C@H]1CN(C(=O)OC(C)(C)C)CCN21 |
| InChI | InChI=1S/C22H29F3N4O6/c1-20(2,3)34-18(31)27-15-14(22(23,24)25)9-13-16(26-15)29-8-7-28(19(32)35-21(4,5)6)10-12(29)11-33-17(13)30/h9,12H,7-8,10-11H2,1-6H3,(H,26,27,31)/t12-/m1/s1 |
| InChIKey | FTEWIVVIMLZGAA-GFCCVEGCSA-N |
| XLogP | 4.04 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|