C30H17ClO — CID 171588045
7-chloro-1-(1,3,6,7,8,9,10,11-octadeuteriotriphenylen-2-yl)dibenzofuran (PubChem CID 171588045) has the molecular formula C30H17ClO and a molecular weight of 436.97 g/mol. Its IUPAC name is 7-chloro-1-(1,3,6,7,8,9,10,11-octadeuteriotriphenylen-2-yl)dibenzofuran.
| Compound Name | 7-chloro-1-(1,3,6,7,8,9,10,11-octadeuteriotriphenylen-2-yl)dibenzofuran |
|---|---|
| PubChem CID | 171588045 |
| Molecular Formula | C30H17ClO |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 7-chloro-1-(1,3,6,7,8,9,10,11-octadeuteriotriphenylen-2-yl)dibenzofuran |
| SMILES | [2H]c1cc2c3cc([2H])c(-c4cccc5oc6cc(Cl)ccc6c45)c([2H])c3c3cc([2H])c([2H])c([2H])c3c2c([2H])c1[2H] |
| InChI | InChI=1S/C30H17ClO/c31-19-13-15-26-29(17-19)32-28-11-5-10-20(30(26)28)18-12-14-25-23-8-2-1-6-21(23)22-7-3-4-9-24(22)27(25)16-18/h1-17H/i1D,2D,3D,4D,6D,7D,12D,16D |
| InChIKey | ZWFZRINWTOFYAF-PLNSLKSGSA-N |
| XLogP | 9.37 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|