About 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium
1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium (PubChem CID 171588107) has the molecular formula C22H37Cl3N3Pd-
and a molecular weight of 556.34 g/mol. Its IUPAC name is 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium.
Molecular Properties
| Compound Name | 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium |
| PubChem CID | 171588107 |
| Molecular Formula | C22H37Cl3N3Pd- |
| Molecular Weight | 556.34 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium |
| SMILES | CCC(CC)(CC)N1C=CN(C(CC)(CC)CC)[CH-]1.Cl[Pd]Cl.Clc1cccnc1 |
| InChI | InChI=1S/C17H33N2.C5H4ClN.2ClH.Pd/c1-7-16(8-2,9-3)18-13-14-19(15-18)17(10-4,11-5)12-6;6-5-2-1-3-7-4-5;;;/h13-15H,7-12H2,1-6H3;1-4H;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | AUPBUNXRIBPZMJ-UHFFFAOYSA-L |
| XLogP | 8.24 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.34 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium?
The IUPAC name of 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium (CID 171588107) is 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium.
What is the SMILES notation for 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium?
The canonical SMILES for 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium is CCC(CC)(CC)N1C=CN(C(CC)(CC)CC)[CH-]1.Cl[Pd]Cl.Clc1cccnc1.
What is the InChIKey of 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium?
The InChIKey is AUPBUNXRIBPZMJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H33N2.C5H4ClN.2ClH.Pd/c1-7-16(8-2,9-3)18-13-14-19(15-18)17(10-4,11-5)12-6;6-5-2-1-3-7-4-5;;;/h13-15H,7-12H2,1-6H3;1-4H;2*1H;/q-1;;;;+2/p-2.
What are the key properties of 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium?
1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium has a molecular weight of 556.34 g/mol, XLogP of 8.24, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(3-ethylpentan-3-yl)-2H-imidazol-2-ide;3-chloropyridine;dichloropalladium is sourced from PubChem (CID 171588107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).