C49H33NOS — CID 171588882
2,3,4-trideuterio-N-(9,9-dimethylfluoren-2-yl)-8-naphthalen-1-yl-N-(6,7,8,9-tetradeuteriodibenzothiophen-1-yl)dibenzofuran-1-amine (PubChem CID 171588882) has the molecular formula C49H33NOS and a molecular weight of 690.92 g/mol. Its IUPAC name is 2,3,4-trideuterio-N-(9,9-dimethylfluoren-2-yl)-8-naphthalen-1-yl-N-(6,7,8,9-tetradeuteriodibenzothiophen-1-yl)dibenzofuran-1-amine.
| Compound Name | 2,3,4-trideuterio-N-(9,9-dimethylfluoren-2-yl)-8-naphthalen-1-yl-N-(6,7,8,9-tetradeuteriodibenzothiophen-1-yl)dibenzofuran-1-amine |
|---|---|
| PubChem CID | 171588882 |
| Molecular Formula | C49H33NOS |
| Molecular Weight | 690.92 g/mol |
| Exact Mass | 690.27 |
| IUPAC Name | 2,3,4-trideuterio-N-(9,9-dimethylfluoren-2-yl)-8-naphthalen-1-yl-N-(6,7,8,9-tetradeuteriodibenzothiophen-1-yl)dibenzofuran-1-amine |
| SMILES | [2H]c1c([2H])c(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2cccc3sc4c([2H])c([2H])c([2H])c([2H])c4c23)c2c(oc3ccc(-c4cccc5ccccc45)cc32)c1[2H] |
| InChI | InChI=1S/C49H33NOS/c1-49(2)39-18-7-5-15-35(39)36-26-25-32(29-40(36)49)50(42-20-11-23-46-48(42)37-16-6-8-22-45(37)52-46)41-19-10-21-44-47(41)38-28-31(24-27-43(38)51-44)34-17-9-13-30-12-3-4-14-33(30)34/h3-29H,1-2H3/i6D,8D,10D,16D,19D,21D,22D |
| InChIKey | HQQZGEXZHULQCP-LFTFQZQUSA-N |
| XLogP | 14.55 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.92 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |