C26H16BNO2S — CID 171588909
(7-cyanospiro[fluorene-9,9'-thioxanthene]-4-yl)boronic acid (PubChem CID 171588909) has the molecular formula C26H16BNO2S and a molecular weight of 417.30 g/mol. Its IUPAC name is (7-cyanospiro[fluorene-9,9'-thioxanthene]-4-yl)boronic acid.
| Compound Name | (7-cyanospiro[fluorene-9,9'-thioxanthene]-4-yl)boronic acid |
|---|---|
| PubChem CID | 171588909 |
| Molecular Formula | C26H16BNO2S |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (7-cyanospiro[fluorene-9,9'-thioxanthene]-4-yl)boronic acid |
| SMILES | N#Cc1ccc2c(c1)C1(c3ccccc3Sc3ccccc31)c1cccc(B(O)O)c1-2 |
| InChI | InChI=1S/C26H16BNO2S/c28-15-16-12-13-17-21(14-16)26(20-8-5-9-22(25(17)20)27(29)30)18-6-1-3-10-23(18)31-24-11-4-2-7-19(24)26/h1-14,29-30H |
| InChIKey | CHMIZUKOSAMAKC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|