C23H16BNO2 — CID 171588979
[3-(3-isocyanophenyl)-5-naphthalen-1-ylphenyl]boronic acid (PubChem CID 171588979) has the molecular formula C23H16BNO2 and a molecular weight of 349.20 g/mol. Its IUPAC name is [3-(3-isocyanophenyl)-5-naphthalen-1-ylphenyl]boronic acid.
| Compound Name | [3-(3-isocyanophenyl)-5-naphthalen-1-ylphenyl]boronic acid |
|---|---|
| PubChem CID | 171588979 |
| Molecular Formula | C23H16BNO2 |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [3-(3-isocyanophenyl)-5-naphthalen-1-ylphenyl]boronic acid |
| SMILES | [C-]#[N+]c1cccc(-c2cc(B(O)O)cc(-c3cccc4ccccc34)c2)c1 |
| InChI | InChI=1S/C23H16BNO2/c1-25-21-9-4-8-17(15-21)18-12-19(14-20(13-18)24(26)27)23-11-5-7-16-6-2-3-10-22(16)23/h2-15,26-27H |
| InChIKey | QRCFEIHHENYQMP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 44.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|