C21H25NO3 — CID 171589104
1-isocyano-2,5-dimethoxy-4-[4-(2-methoxyphenyl)-2-methylbutyl]benzene (PubChem CID 171589104) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-isocyano-2,5-dimethoxy-4-[4-(2-methoxyphenyl)-2-methylbutyl]benzene.
| Compound Name | 1-isocyano-2,5-dimethoxy-4-[4-(2-methoxyphenyl)-2-methylbutyl]benzene |
|---|---|
| PubChem CID | 171589104 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-isocyano-2,5-dimethoxy-4-[4-(2-methoxyphenyl)-2-methylbutyl]benzene |
| SMILES | [C-]#[N+]c1cc(OC)c(CC(C)CCc2ccccc2OC)cc1OC |
| InChI | InChI=1S/C21H25NO3/c1-15(10-11-16-8-6-7-9-19(16)23-3)12-17-13-21(25-5)18(22-2)14-20(17)24-4/h6-9,13-15H,10-12H2,1,3-5H3 |
| InChIKey | KCPKTIOUMHLKAZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|