About CID 171589226
CID 171589226 (PubChem CID 171589226) has the molecular formula C17H38N3Sn
and a molecular weight of 403.22 g/mol.
Molecular Properties
| Compound Name | CID 171589226 |
| PubChem CID | 171589226 |
| Molecular Formula | C17H38N3Sn |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | — |
| SMILES | CCC1N(C(C)(C)C)[Sn](N(C(C)C)C(C)C)N1C(C)(C)C |
| InChI | InChI=1S/C11H24N2.C6H14N.Sn/c1-8-9(12-10(2,3)4)13-11(5,6)7;1-5(2)7-6(3)4;/h9H,8H2,1-7H3;5-6H,1-4H3;/q-2;-1;+3 |
| InChIKey | MBYVXSKBDIILEX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 171589226 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171589226?
The IUPAC name of CID 171589226 (CID 171589226) is not available.
What is the SMILES notation for CID 171589226?
The canonical SMILES for CID 171589226 is CCC1N(C(C)(C)C)[Sn](N(C(C)C)C(C)C)N1C(C)(C)C.
What is the InChIKey of CID 171589226?
The InChIKey is MBYVXSKBDIILEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2.C6H14N.Sn/c1-8-9(12-10(2,3)4)13-11(5,6)7;1-5(2)7-6(3)4;/h9H,8H2,1-7H3;5-6H,1-4H3;/q-2;-1;+3.
What are the key properties of CID 171589226?
CID 171589226 has a molecular weight of 403.22 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171589226 is sourced from PubChem (CID 171589226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).