C19H23N7O14P2S-2 — CID 171590109
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphinothioyl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 171590109) has the molecular formula C19H23N7O14P2S-2 and a molecular weight of 667.44 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphinothioyl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphinothioyl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 171590109 |
| Molecular Formula | C19H23N7O14P2S-2 |
| Molecular Weight | 667.44 g/mol |
| Exact Mass | 667.05 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphinothioyl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP([O-])(=S)OP(=O)([O-])OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H25N7O14P2S/c20-15-10-16(22-5-21-15)26(6-23-10)18-14(31)12(29)8(39-18)4-37-42(35,43)40-41(33,34)36-3-7-11(28)13(30)17(38-7)25-2-1-9(27)24-19(25)32/h1-2,5-8,11-14,17-18,28-31H,3-4H2,(H,33,34)(H,35,43)(H2,20,21,22)(H,24,27,32)/p-2/t7-,8-,11-,12-,13-,14-,17-,18-,42?/m1/s1 |
| InChIKey | KBLWRULKHVQTOE-KRIVUSCESA-L |
| XLogP | -4.70 |
| TPSA | 314.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.44 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|