C13H24FNO — CID 171590851
(4R)-2-(2-fluoroethyl)-3-[(2-methylpropan-2-yl)oxymethyl]-2-azabicyclo[2.2.1]heptane (PubChem CID 171590851) has the molecular formula C13H24FNO and a molecular weight of 229.34 g/mol. Its IUPAC name is (4R)-2-(2-fluoroethyl)-3-[(2-methylpropan-2-yl)oxymethyl]-2-azabicyclo[2.2.1]heptane.
| Compound Name | (4R)-2-(2-fluoroethyl)-3-[(2-methylpropan-2-yl)oxymethyl]-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 171590851 |
| Molecular Formula | C13H24FNO |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (4R)-2-(2-fluoroethyl)-3-[(2-methylpropan-2-yl)oxymethyl]-2-azabicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)OCC1[C@@H]2CCC(C2)N1CCF |
| InChI | InChI=1S/C13H24FNO/c1-13(2,3)16-9-12-10-4-5-11(8-10)15(12)7-6-14/h10-12H,4-9H2,1-3H3/t10-,11?,12?/m1/s1 |
| InChIKey | MPVIFNRFAMLGCA-VOMCLLRMSA-N |
| XLogP | 2.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |