About 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde
2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde (PubChem CID 171591221) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde.
Molecular Properties
| Compound Name | 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde |
| PubChem CID | 171591221 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde |
| SMILES | CC1(C=O)COC(C)(CCc2ccccc2)OC1 |
| InChI | InChI=1S/C15H20O3/c1-14(10-16)11-17-15(2,18-12-14)9-8-13-6-4-3-5-7-13/h3-7,10H,8-9,11-12H2,1-2H3 |
| InChIKey | OHSONZMJXFJDBG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde?
The IUPAC name of 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde (CID 171591221) is 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde.
What is the SMILES notation for 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde?
The canonical SMILES for 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde is CC1(C=O)COC(C)(CCc2ccccc2)OC1.
What is the InChIKey of 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde?
The InChIKey is OHSONZMJXFJDBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-14(10-16)11-17-15(2,18-12-14)9-8-13-6-4-3-5-7-13/h3-7,10H,8-9,11-12H2,1-2H3.
What are the key properties of 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde?
2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde has a molecular weight of 248.32 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-2-(2-phenylethyl)-1,3-dioxane-5-carbaldehyde is sourced from PubChem (CID 171591221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).