C12H15NO — CID 151126752
4-methyl-4-(2-phenylethyl)-5H-1,3-oxazole (PubChem CID 151126752) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-methyl-4-(2-phenylethyl)-5H-1,3-oxazole.
| Compound Name | 4-methyl-4-(2-phenylethyl)-5H-1,3-oxazole |
|---|---|
| PubChem CID | 151126752 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 4-methyl-4-(2-phenylethyl)-5H-1,3-oxazole |
| SMILES | CC1(CCc2ccccc2)COC=N1 |
| InChI | InChI=1S/C12H15NO/c1-12(9-14-10-13-12)8-7-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3 |
| InChIKey | MTIVFSPDTKRQJZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |