C23H33N3O6 — CID 171592344
[2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-1-[3-[2-(2-hydroxyethoxy)ethoxy]-1-adamantyl]-2-oxoethyl] carbamate (PubChem CID 171592344) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is [2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-1-[3-[2-(2-hydroxyethoxy)ethoxy]-1-adamantyl]-2-oxoethyl] carbamate.
| Compound Name | [2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-1-[3-[2-(2-hydroxyethoxy)ethoxy]-1-adamantyl]-2-oxoethyl] carbamate |
|---|---|
| PubChem CID | 171592344 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | [2-[(1S,3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-1-[3-[2-(2-hydroxyethoxy)ethoxy]-1-adamantyl]-2-oxoethyl] carbamate |
| SMILES | N#C[C@@H]1C[C@@H]2C[C@@H]2N1C(=O)C(OC(N)=O)C12CC3CC(CC(OCCOCCO)(C3)C1)C2 |
| InChI | InChI=1S/C23H33N3O6/c24-12-17-6-16-7-18(16)26(17)20(28)19(32-21(25)29)22-8-14-5-15(9-22)11-23(10-14,13-22)31-4-3-30-2-1-27/h14-19,27H,1-11,13H2,(H2,25,29)/t14?,15?,16-,17+,18+,19?,22?,23?/m1/s1 |
| InChIKey | ZRQGZVYFDFBJCV-SSQCNQRLSA-N |
| XLogP | 1.33 |
| TPSA | 135.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|