C14H11N3O2S — CID 171594917
N-[(4-nitrophenyl)methyl]-1,2-benzothiazol-3-amine (PubChem CID 171594917) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is N-[(4-nitrophenyl)methyl]-1,2-benzothiazol-3-amine.
| Compound Name | N-[(4-nitrophenyl)methyl]-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 171594917 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-[(4-nitrophenyl)methyl]-1,2-benzothiazol-3-amine |
| SMILES | O=[N+]([O-])c1ccc(CNc2nsc3ccccc23)cc1 |
| InChI | InChI=1S/C14H11N3O2S/c18-17(19)11-7-5-10(6-8-11)9-15-14-12-3-1-2-4-13(12)20-16-14/h1-8H,9H2,(H,15,16) |
| InChIKey | MYFVCAQRVGBKTG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|