C13H16N4O2S — CID 65271572
3-tert-butyl-N-[(4-nitrophenyl)methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 65271572) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-tert-butyl-N-[(4-nitrophenyl)methyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-tert-butyl-N-[(4-nitrophenyl)methyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65271572 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-tert-butyl-N-[(4-nitrophenyl)methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)(C)c1nsc(NCc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C13H16N4O2S/c1-13(2,3)11-15-12(20-16-11)14-8-9-4-6-10(7-5-9)17(18)19/h4-7H,8H2,1-3H3,(H,14,15,16) |
| InChIKey | GCWYHPXJMOQKSE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|