C46H29N5O — CID 171597007
9-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-isocyanophenyl)-N-(4-phenylphenyl)dibenzofuran-3-amine (PubChem CID 171597007) has the molecular formula C46H29N5O and a molecular weight of 667.77 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-isocyanophenyl)-N-(4-phenylphenyl)dibenzofuran-3-amine.
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-isocyanophenyl)-N-(4-phenylphenyl)dibenzofuran-3-amine |
|---|---|
| PubChem CID | 171597007 |
| Molecular Formula | C46H29N5O |
| Molecular Weight | 667.77 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-isocyanophenyl)-N-(4-phenylphenyl)dibenzofuran-3-amine |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc3c(c2)oc2cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c23)cc1 |
| InChI | InChI=1S/C46H29N5O/c1-47-35-22-26-37(27-23-35)51(36-24-20-32(21-25-36)31-12-5-2-6-13-31)38-28-29-39-42(30-38)52-41-19-11-18-40(43(39)41)46-49-44(33-14-7-3-8-15-33)48-45(50-46)34-16-9-4-10-17-34/h2-30H |
| InChIKey | BOYOWCGSCZKYNM-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 59.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.77 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|