C56H42O4 — CID 171600428
1,6-bis[3,5-bis(4-methoxyphenyl)phenyl]pyrene (PubChem CID 171600428) has the molecular formula C56H42O4 and a molecular weight of 778.95 g/mol. Its IUPAC name is 1,6-bis[3,5-bis(4-methoxyphenyl)phenyl]pyrene.
| Compound Name | 1,6-bis[3,5-bis(4-methoxyphenyl)phenyl]pyrene |
|---|---|
| PubChem CID | 171600428 |
| Molecular Formula | C56H42O4 |
| Molecular Weight | 778.95 g/mol |
| Exact Mass | 778.31 |
| IUPAC Name | 1,6-bis[3,5-bis(4-methoxyphenyl)phenyl]pyrene |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3)cc(-c3ccc4ccc5c(-c6cc(-c7ccc(OC)cc7)cc(-c7ccc(OC)cc7)c6)ccc6ccc3c4c65)c2)cc1 |
| InChI | InChI=1S/C56H42O4/c1-57-47-17-5-35(6-18-47)41-29-42(36-7-19-48(58-2)20-8-36)32-45(31-41)51-25-13-39-16-28-54-52(26-14-40-15-27-53(51)55(39)56(40)54)46-33-43(37-9-21-49(59-3)22-10-37)30-44(34-46)38-11-23-50(60-4)24-12-38/h5-34H,1-4H3 |
| InChIKey | IKBXLFNTOBHLPK-UHFFFAOYSA-N |
| XLogP | 14.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.95 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|