C22H28IN3O9P+ — CID 171600632
[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-[6-[(3-iodobenzoyl)amino]hexoxy]oxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 171600632) has the molecular formula C22H28IN3O9P+ and a molecular weight of 636.36 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-[6-[(3-iodobenzoyl)amino]hexoxy]oxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-[6-[(3-iodobenzoyl)amino]hexoxy]oxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 171600632 |
| Molecular Formula | C22H28IN3O9P+ |
| Molecular Weight | 636.36 g/mol |
| Exact Mass | 636.06 |
| IUPAC Name | [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-[6-[(3-iodobenzoyl)amino]hexoxy]oxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | O=C(NCCCCCCOC1[C@@H](O[P+](=O)O)[C@@H](CO)O[C@H]1n1ccc(=O)[nH]c1=O)c1cccc(I)c1 |
| InChI | InChI=1S/C22H27IN3O9P/c23-15-7-5-6-14(12-15)20(29)24-9-3-1-2-4-11-33-19-18(35-36(31)32)16(13-27)34-21(19)26-10-8-17(28)25-22(26)30/h5-8,10,12,16,18-19,21,27H,1-4,9,11,13H2,(H2-,24,25,28,29,30,31,32)/p+1/t16-,18+,19?,21-/m1/s1 |
| InChIKey | MISWVNOVZWFEKV-CVDOAWBMSA-O |
| XLogP | 1.44 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|