C27H29F3N6O3 — CID 171608728
N-[cyano(imidazo[1,2-a]pyridin-3-yl)methyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide (PubChem CID 171608728) has the molecular formula C27H29F3N6O3 and a molecular weight of 542.56 g/mol. Its IUPAC name is N-[cyano(imidazo[1,2-a]pyridin-3-yl)methyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide.
| Compound Name | N-[cyano(imidazo[1,2-a]pyridin-3-yl)methyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
|---|---|
| PubChem CID | 171608728 |
| Molecular Formula | C27H29F3N6O3 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | N-[cyano(imidazo[1,2-a]pyridin-3-yl)methyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)C(F)(F)F)C(=O)N1CC2C3C=CC(C3)C2C1C(=O)NC(C#N)c1cnc2ccccn12 |
| InChI | InChI=1S/C27H29F3N6O3/c1-26(2,3)22(34-25(39)27(28,29)30)24(38)36-13-16-14-7-8-15(10-14)20(16)21(36)23(37)33-17(11-31)18-12-32-19-6-4-5-9-35(18)19/h4-9,12,14-17,20-22H,10,13H2,1-3H3,(H,33,37)(H,34,39)/t14?,15?,16?,17?,20?,21?,22-/m1/s1 |
| InChIKey | SDBOPVRRFQPOJG-CXSXFMFUSA-N |
| XLogP | 2.76 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|