C47H36N4O — CID 171610282
2-[3-[3-(2,6-diphenylphenyl)-2H-imidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-propan-2-yl-2-pyridinyl)carbazole (PubChem CID 171610282) has the molecular formula C47H36N4O and a molecular weight of 672.83 g/mol. Its IUPAC name is 2-[3-[3-(2,6-diphenylphenyl)-2H-imidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-propan-2-yl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-[3-(2,6-diphenylphenyl)-2H-imidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-propan-2-yl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 171610282 |
| Molecular Formula | C47H36N4O |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | 2-[3-[3-(2,6-diphenylphenyl)-2H-imidazol-3-ium-2-id-1-yl]phenoxy]-9-(4-propan-2-yl-2-pyridinyl)carbazole |
| SMILES | CC(C)c1ccnc(-n2c3ccccc3c3ccc(Oc4cccc(-n5[c-][n+](-c6c(-c7ccccc7)cccc6-c6ccccc6)cc5)c4)cc32)c1 |
| InChI | InChI=1S/C47H36N4O/c1-33(2)36-25-26-48-46(29-36)51-44-22-10-9-19-42(44)43-24-23-39(31-45(43)51)52-38-18-11-17-37(30-38)49-27-28-50(32-49)47-40(34-13-5-3-6-14-34)20-12-21-41(47)35-15-7-4-8-16-35/h3-31,33H,1-2H3 |
| InChIKey | SRNQYFAXRYCUOT-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|